C11H9ClN4O2S — CID 106139096
4-chloro-N-(4-cyanophenyl)-1-methylpyrazole-5-sulfonamide (PubChem CID 106139096) has the molecular formula C11H9ClN4O2S and a molecular weight of 296.74 g/mol. Its IUPAC name is 4-chloro-N-(4-cyanophenyl)-1-methylpyrazole-5-sulfonamide.
| Compound Name | 4-chloro-N-(4-cyanophenyl)-1-methylpyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106139096 |
| Molecular Formula | C11H9ClN4O2S |
| Molecular Weight | 296.74 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 4-chloro-N-(4-cyanophenyl)-1-methylpyrazole-5-sulfonamide |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C11H9ClN4O2S/c1-16-11(10(12)7-14-16)19(17,18)15-9-4-2-8(6-13)3-5-9/h2-5,7,15H,1H3 |
| InChIKey | GAPZXBPSAVDELE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.74 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |