C11H15Cl3N2O3S — CID 83039704
2,4,6-trichloro-N-[2-(2-methoxyethylamino)ethyl]benzenesulfonamide (PubChem CID 83039704) has the molecular formula C11H15Cl3N2O3S and a molecular weight of 361.68 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[2-(2-methoxyethylamino)ethyl]benzenesulfonamide.
| Compound Name | 2,4,6-trichloro-N-[2-(2-methoxyethylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 83039704 |
| Molecular Formula | C11H15Cl3N2O3S |
| Molecular Weight | 361.68 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 2,4,6-trichloro-N-[2-(2-methoxyethylamino)ethyl]benzenesulfonamide |
| SMILES | COCCNCCNS(=O)(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H15Cl3N2O3S/c1-19-5-4-15-2-3-16-20(17,18)11-9(13)6-8(12)7-10(11)14/h6-7,15-16H,2-5H2,1H3 |
| InChIKey | AELABDKNVMKJIE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.68 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|