C12H18Cl2N2O3S — CID 120717866
1-(3,5-dichlorophenyl)-N-[2-(2-methoxyethylamino)ethyl]methanesulfonamide (PubChem CID 120717866) has the molecular formula C12H18Cl2N2O3S and a molecular weight of 341.26 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-N-[2-(2-methoxyethylamino)ethyl]methanesulfonamide.
| Compound Name | 1-(3,5-dichlorophenyl)-N-[2-(2-methoxyethylamino)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 120717866 |
| Molecular Formula | C12H18Cl2N2O3S |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-N-[2-(2-methoxyethylamino)ethyl]methanesulfonamide |
| SMILES | COCCNCCNS(=O)(=O)Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H18Cl2N2O3S/c1-19-5-4-15-2-3-16-20(17,18)9-10-6-11(13)8-12(14)7-10/h6-8,15-16H,2-5,9H2,1H3 |
| InChIKey | XYLKUCHVQOPHOI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|