C13H23ClN2O3S — CID 120717380
N-[2-(2-methoxyethylamino)ethyl]-2-phenylethanesulfonamide;hydrochloride (PubChem CID 120717380) has the molecular formula C13H23ClN2O3S and a molecular weight of 322.86 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)ethyl]-2-phenylethanesulfonamide;hydrochloride.
| Compound Name | N-[2-(2-methoxyethylamino)ethyl]-2-phenylethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717380 |
| Molecular Formula | C13H23ClN2O3S |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-[2-(2-methoxyethylamino)ethyl]-2-phenylethanesulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)CCc1ccccc1.Cl |
| InChI | InChI=1S/C13H22N2O3S.ClH/c1-18-11-10-14-8-9-15-19(16,17)12-7-13-5-3-2-4-6-13;/h2-6,14-15H,7-12H2,1H3;1H |
| InChIKey | IPYXWKPATKCWQK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|