C10H10Cl2F3NO2S — CID 75384497
1-(3,5-dichlorophenyl)-N-(3,3,3-trifluoropropyl)methanesulfonamide (PubChem CID 75384497) has the molecular formula C10H10Cl2F3NO2S and a molecular weight of 336.16 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-N-(3,3,3-trifluoropropyl)methanesulfonamide.
| Compound Name | 1-(3,5-dichlorophenyl)-N-(3,3,3-trifluoropropyl)methanesulfonamide |
|---|---|
| PubChem CID | 75384497 |
| Molecular Formula | C10H10Cl2F3NO2S |
| Molecular Weight | 336.16 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-N-(3,3,3-trifluoropropyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1cc(Cl)cc(Cl)c1)NCCC(F)(F)F |
| InChI | InChI=1S/C10H10Cl2F3NO2S/c11-8-3-7(4-9(12)5-8)6-19(17,18)16-2-1-10(13,14)15/h3-5,16H,1-2,6H2 |
| InChIKey | DWGWUPTUVMKENZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.16 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |