C11H17BrCl2N2O3S — CID 120717944
5-bromo-2-chloro-N-[2-(2-methoxyethylamino)ethyl]benzenesulfonamide;hydrochloride (PubChem CID 120717944) has the molecular formula C11H17BrCl2N2O3S and a molecular weight of 408.15 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[2-(2-methoxyethylamino)ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 5-bromo-2-chloro-N-[2-(2-methoxyethylamino)ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717944 |
| Molecular Formula | C11H17BrCl2N2O3S |
| Molecular Weight | 408.15 g/mol |
| Exact Mass | 405.95 |
| IUPAC Name | 5-bromo-2-chloro-N-[2-(2-methoxyethylamino)ethyl]benzenesulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1cc(Br)ccc1Cl.Cl |
| InChI | InChI=1S/C11H16BrClN2O3S.ClH/c1-18-7-6-14-4-5-15-19(16,17)11-8-9(12)2-3-10(11)13;/h2-3,8,14-15H,4-7H2,1H3;1H |
| InChIKey | RMZCUDGGEBHHCU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.15 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|