C11H16ClN3O5S — CID 120717656
5-chloro-N-[2-(2-methoxyethylamino)ethyl]-2-nitrobenzenesulfonamide (PubChem CID 120717656) has the molecular formula C11H16ClN3O5S and a molecular weight of 337.79 g/mol. Its IUPAC name is 5-chloro-N-[2-(2-methoxyethylamino)ethyl]-2-nitrobenzenesulfonamide.
| Compound Name | 5-chloro-N-[2-(2-methoxyethylamino)ethyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 120717656 |
| Molecular Formula | C11H16ClN3O5S |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 5-chloro-N-[2-(2-methoxyethylamino)ethyl]-2-nitrobenzenesulfonamide |
| SMILES | COCCNCCNS(=O)(=O)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16ClN3O5S/c1-20-7-6-13-4-5-14-21(18,19)11-8-9(12)2-3-10(11)15(16)17/h2-3,8,13-14H,4-7H2,1H3 |
| InChIKey | FTUIGDPIJQKMDS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|