C13H19N3O7S — CID 120717476
N-[2-(2-methoxyethylamino)ethyl]-7-nitro-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 120717476) has the molecular formula C13H19N3O7S and a molecular weight of 361.38 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)ethyl]-7-nitro-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[2-(2-methoxyethylamino)ethyl]-7-nitro-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 120717476 |
| Molecular Formula | C13H19N3O7S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-[2-(2-methoxyethylamino)ethyl]-7-nitro-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | COCCNCCNS(=O)(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2 |
| InChI | InChI=1S/C13H19N3O7S/c1-21-5-4-14-2-3-15-24(19,20)13-9-12-11(22-6-7-23-12)8-10(13)16(17)18/h8-9,14-15H,2-7H2,1H3 |
| InChIKey | KQAGTCYUAXOXKT-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|