C14H21N3O6S — CID 119989836
N-(2-amino-2-ethylbutyl)-7-nitro-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 119989836) has the molecular formula C14H21N3O6S and a molecular weight of 359.40 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-7-nitro-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-7-nitro-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 119989836 |
| Molecular Formula | C14H21N3O6S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-7-nitro-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | CCC(N)(CC)CNS(=O)(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2 |
| InChI | InChI=1S/C14H21N3O6S/c1-3-14(15,4-2)9-16-24(20,21)13-8-12-11(22-5-6-23-12)7-10(13)17(18)19/h7-8,16H,3-6,9,15H2,1-2H3 |
| InChIKey | HCTWWHVGGNIYLN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|