C13H22ClN3O5S — CID 120717643
N-[2-(2-methoxyethylamino)ethyl]-4,5-dimethyl-2-nitrobenzenesulfonamide;hydrochloride (PubChem CID 120717643) has the molecular formula C13H22ClN3O5S and a molecular weight of 367.86 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)ethyl]-4,5-dimethyl-2-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(2-methoxyethylamino)ethyl]-4,5-dimethyl-2-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717643 |
| Molecular Formula | C13H22ClN3O5S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-[2-(2-methoxyethylamino)ethyl]-4,5-dimethyl-2-nitrobenzenesulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1cc(C)c(C)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C13H21N3O5S.ClH/c1-10-8-12(16(17)18)13(9-11(10)2)22(19,20)15-5-4-14-6-7-21-3;/h8-9,14-15H,4-7H2,1-3H3;1H |
| InChIKey | CHAFLTXDUBLSEA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|