C10H15ClN4O3S — CID 106150631
4-chloro-N-(2-cyanoethyl)-N-(2-methoxyethyl)-1-methylpyrazole-5-sulfonamide (PubChem CID 106150631) has the molecular formula C10H15ClN4O3S and a molecular weight of 306.78 g/mol. Its IUPAC name is 4-chloro-N-(2-cyanoethyl)-N-(2-methoxyethyl)-1-methylpyrazole-5-sulfonamide.
| Compound Name | 4-chloro-N-(2-cyanoethyl)-N-(2-methoxyethyl)-1-methylpyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106150631 |
| Molecular Formula | C10H15ClN4O3S |
| Molecular Weight | 306.78 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 4-chloro-N-(2-cyanoethyl)-N-(2-methoxyethyl)-1-methylpyrazole-5-sulfonamide |
| SMILES | COCCN(CCC#N)S(=O)(=O)c1c(Cl)cnn1C |
| InChI | InChI=1S/C10H15ClN4O3S/c1-14-10(9(11)8-13-14)19(16,17)15(5-3-4-12)6-7-18-2/h8H,3,5-7H2,1-2H3 |
| InChIKey | MZLNOZWWFNIIEY-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.78 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |