C14H21N3O3S — CID 63287106
5-amino-N-(2-cyanoethyl)-N-(2-methoxyethyl)-2,3-dimethylbenzenesulfonamide (PubChem CID 63287106) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 5-amino-N-(2-cyanoethyl)-N-(2-methoxyethyl)-2,3-dimethylbenzenesulfonamide.
| Compound Name | 5-amino-N-(2-cyanoethyl)-N-(2-methoxyethyl)-2,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 63287106 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 5-amino-N-(2-cyanoethyl)-N-(2-methoxyethyl)-2,3-dimethylbenzenesulfonamide |
| SMILES | COCCN(CCC#N)S(=O)(=O)c1cc(N)cc(C)c1C |
| InChI | InChI=1S/C14H21N3O3S/c1-11-9-13(16)10-14(12(11)2)21(18,19)17(6-4-5-15)7-8-20-3/h9-10H,4,6-8,16H2,1-3H3 |
| InChIKey | JKXNBKHHWKMGKI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|