C12H13FN4O2S — CID 61140977
5-amino-N,N-bis(2-cyanoethyl)-2-fluorobenzenesulfonamide (PubChem CID 61140977) has the molecular formula C12H13FN4O2S and a molecular weight of 296.33 g/mol. Its IUPAC name is 5-amino-N,N-bis(2-cyanoethyl)-2-fluorobenzenesulfonamide.
| Compound Name | 5-amino-N,N-bis(2-cyanoethyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 61140977 |
| Molecular Formula | C12H13FN4O2S |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 5-amino-N,N-bis(2-cyanoethyl)-2-fluorobenzenesulfonamide |
| SMILES | N#CCCN(CCC#N)S(=O)(=O)c1cc(N)ccc1F |
| InChI | InChI=1S/C12H13FN4O2S/c13-11-4-3-10(16)9-12(11)20(18,19)17(7-1-5-14)8-2-6-15/h3-4,9H,1-2,7-8,16H2 |
| InChIKey | PACCUMTZNJSDCQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|