C12H15FN2O4S2 — CID 61046290
N-(2-cyanoethyl)-N-ethyl-2-fluoro-5-methylsulfonylbenzenesulfonamide (PubChem CID 61046290) has the molecular formula C12H15FN2O4S2 and a molecular weight of 334.39 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-ethyl-2-fluoro-5-methylsulfonylbenzenesulfonamide.
| Compound Name | N-(2-cyanoethyl)-N-ethyl-2-fluoro-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 61046290 |
| Molecular Formula | C12H15FN2O4S2 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | N-(2-cyanoethyl)-N-ethyl-2-fluoro-5-methylsulfonylbenzenesulfonamide |
| SMILES | CCN(CCC#N)S(=O)(=O)c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C12H15FN2O4S2/c1-3-15(8-4-7-14)21(18,19)12-9-10(20(2,16)17)5-6-11(12)13/h5-6,9H,3-4,8H2,1-2H3 |
| InChIKey | NNWFHVOAXGTIHS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 95.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |