C13H20FNO4S2 — CID 43454763
N-butan-2-yl-N-ethyl-2-fluoro-5-methylsulfonylbenzenesulfonamide (PubChem CID 43454763) has the molecular formula C13H20FNO4S2 and a molecular weight of 337.44 g/mol. Its IUPAC name is N-butan-2-yl-N-ethyl-2-fluoro-5-methylsulfonylbenzenesulfonamide.
| Compound Name | N-butan-2-yl-N-ethyl-2-fluoro-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 43454763 |
| Molecular Formula | C13H20FNO4S2 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | N-butan-2-yl-N-ethyl-2-fluoro-5-methylsulfonylbenzenesulfonamide |
| SMILES | CCC(C)N(CC)S(=O)(=O)c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C13H20FNO4S2/c1-5-10(3)15(6-2)21(18,19)13-9-11(20(4,16)17)7-8-12(13)14/h7-10H,5-6H2,1-4H3 |
| InChIKey | LFQRPWKWXUVQAO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |