C13H22N2O4S2 — CID 62142912
N-ethyl-2-(methylamino)-5-methylsulfonyl-N-propan-2-ylbenzenesulfonamide (PubChem CID 62142912) has the molecular formula C13H22N2O4S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is N-ethyl-2-(methylamino)-5-methylsulfonyl-N-propan-2-ylbenzenesulfonamide.
| Compound Name | N-ethyl-2-(methylamino)-5-methylsulfonyl-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 62142912 |
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-ethyl-2-(methylamino)-5-methylsulfonyl-N-propan-2-ylbenzenesulfonamide |
| SMILES | CCN(C(C)C)S(=O)(=O)c1cc(S(C)(=O)=O)ccc1NC |
| InChI | InChI=1S/C13H22N2O4S2/c1-6-15(10(2)3)21(18,19)13-9-11(20(5,16)17)7-8-12(13)14-4/h7-10,14H,6H2,1-5H3 |
| InChIKey | KPWDOMGQAPBWQG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |