C12H20N2O4S2 — CID 62150190
2-(ethylamino)-5-methylsulfonyl-N-propan-2-ylbenzenesulfonamide (PubChem CID 62150190) has the molecular formula C12H20N2O4S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-(ethylamino)-5-methylsulfonyl-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 2-(ethylamino)-5-methylsulfonyl-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 62150190 |
| Molecular Formula | C12H20N2O4S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-(ethylamino)-5-methylsulfonyl-N-propan-2-ylbenzenesulfonamide |
| SMILES | CCNc1ccc(S(C)(=O)=O)cc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C12H20N2O4S2/c1-5-13-11-7-6-10(19(4,15)16)8-12(11)20(17,18)14-9(2)3/h6-9,13-14H,5H2,1-4H3 |
| InChIKey | YSPVOJRSCOCKIC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |