C9H14N2O4S2 — CID 61036669
2-(ethylamino)-5-methylsulfonylbenzenesulfonamide (PubChem CID 61036669) has the molecular formula C9H14N2O4S2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-(ethylamino)-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-(ethylamino)-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 61036669 |
| Molecular Formula | C9H14N2O4S2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-(ethylamino)-5-methylsulfonylbenzenesulfonamide |
| SMILES | CCNc1ccc(S(C)(=O)=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C9H14N2O4S2/c1-3-11-8-5-4-7(16(2,12)13)6-9(8)17(10,14)15/h4-6,11H,3H2,1-2H3,(H2,10,14,15) |
| InChIKey | QMWILXDFMJGGFI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |