C16H21N3O6S3 — CID 56563872
4-[2-[(4-methylphenyl)sulfonylamino]ethylamino]-3-methylsulfonylbenzenesulfonamide (PubChem CID 56563872) has the molecular formula C16H21N3O6S3 and a molecular weight of 447.56 g/mol. Its IUPAC name is 4-[2-[(4-methylphenyl)sulfonylamino]ethylamino]-3-methylsulfonylbenzenesulfonamide.
| Compound Name | 4-[2-[(4-methylphenyl)sulfonylamino]ethylamino]-3-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 56563872 |
| Molecular Formula | C16H21N3O6S3 |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 4-[2-[(4-methylphenyl)sulfonylamino]ethylamino]-3-methylsulfonylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNc2ccc(S(N)(=O)=O)cc2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H21N3O6S3/c1-12-3-5-13(6-4-12)28(24,25)19-10-9-18-15-8-7-14(27(17,22)23)11-16(15)26(2,20)21/h3-8,11,18-19H,9-10H2,1-2H3,(H2,17,22,23) |
| InChIKey | ZGRQEOREPMJCRY-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|