C10H14N2O2S — CID 3448478
4-methyl-N-[2-(methylideneamino)ethyl]benzenesulfonamide (PubChem CID 3448478) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 4-methyl-N-[2-(methylideneamino)ethyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-(methylideneamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3448478 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 4-methyl-N-[2-(methylideneamino)ethyl]benzenesulfonamide |
| SMILES | C=NCCNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C10H14N2O2S/c1-9-3-5-10(6-4-9)15(13,14)12-8-7-11-2/h3-6,12H,2,7-8H2,1H3 |
| InChIKey | YUDDQNUHARXUAG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|