C32H34N4O4S2 — CID 101498750
4-methyl-N-[2-[[2-[2-[(4-methylphenyl)sulfonylamino]ethylimino]-1,2-diphenylethylidene]amino]ethyl]benzenesulfonamide (PubChem CID 101498750) has the molecular formula C32H34N4O4S2 and a molecular weight of 602.78 g/mol. Its IUPAC name is 4-methyl-N-[2-[[2-[2-[(4-methylphenyl)sulfonylamino]ethylimino]-1,2-diphenylethylidene]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-[[2-[2-[(4-methylphenyl)sulfonylamino]ethylimino]-1,2-diphenylethylidene]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 101498750 |
| Molecular Formula | C32H34N4O4S2 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | 4-methyl-N-[2-[[2-[2-[(4-methylphenyl)sulfonylamino]ethylimino]-1,2-diphenylethylidene]amino]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC/N=C(C(=N\CCNS(=O)(=O)c2ccc(C)cc2)\c2ccccc2)/c2ccccc2)cc1 |
| InChI | InChI=1S/C32H34N4O4S2/c1-25-13-17-29(18-14-25)41(37,38)35-23-21-33-31(27-9-5-3-6-10-27)32(28-11-7-4-8-12-28)34-22-24-36-42(39,40)30-19-15-26(2)16-20-30/h3-20,35-36H,21-24H2,1-2H3/b33-31-,34-32+ |
| InChIKey | OGJOSMMLGFXBBX-IUQQBYGBSA-N |
| XLogP | 4.54 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|