C17H17NO2S — CID 71512775
4-methyl-N-(2-phenylbuta-2,3-dienyl)benzenesulfonamide (PubChem CID 71512775) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is 4-methyl-N-(2-phenylbuta-2,3-dienyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(2-phenylbuta-2,3-dienyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71512775 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 4-methyl-N-(2-phenylbuta-2,3-dienyl)benzenesulfonamide |
| SMILES | C=C=C(CNS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H17NO2S/c1-3-15(16-7-5-4-6-8-16)13-18-21(19,20)17-11-9-14(2)10-12-17/h4-12,18H,1,13H2,2H3 |
| InChIKey | PIOAJSGBGDOIRW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |