C20H25NO2S — CID 10043080
N-[(2Z)-2-benzylidene-3,3-dimethylbutyl]-4-methylbenzenesulfonamide (PubChem CID 10043080) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is N-[(2Z)-2-benzylidene-3,3-dimethylbutyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2Z)-2-benzylidene-3,3-dimethylbutyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10043080 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-[(2Z)-2-benzylidene-3,3-dimethylbutyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC/C(=C\c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H25NO2S/c1-16-10-12-19(13-11-16)24(22,23)21-15-18(20(2,3)4)14-17-8-6-5-7-9-17/h5-14,21H,15H2,1-4H3/b18-14+ |
| InChIKey | RQFSHURDVOOWFG-NBVRZTHBSA-N |
| XLogP | 4.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |