C12H17NO3S — CID 11402591
N-(2,2-dimethyl-3-oxopropyl)-4-methylbenzenesulfonamide (PubChem CID 11402591) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is N-(2,2-dimethyl-3-oxopropyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(2,2-dimethyl-3-oxopropyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11402591 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-(2,2-dimethyl-3-oxopropyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(C)(C)C=O)cc1 |
| InChI | InChI=1S/C12H17NO3S/c1-10-4-6-11(7-5-10)17(15,16)13-8-12(2,3)9-14/h4-7,9,13H,8H2,1-3H3 |
| InChIKey | JDEGIJFEGZBSJU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|