C27H29NO2S — CID 102424933
N-[2,2-bis(4-methylphenyl)hexa-4,5-dienyl]-4-methylbenzenesulfonamide (PubChem CID 102424933) has the molecular formula C27H29NO2S and a molecular weight of 431.60 g/mol. Its IUPAC name is N-[2,2-bis(4-methylphenyl)hexa-4,5-dienyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2,2-bis(4-methylphenyl)hexa-4,5-dienyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102424933 |
| Molecular Formula | C27H29NO2S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-[2,2-bis(4-methylphenyl)hexa-4,5-dienyl]-4-methylbenzenesulfonamide |
| SMILES | C=C=CCC(CNS(=O)(=O)c1ccc(C)cc1)(c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H29NO2S/c1-5-6-19-27(24-13-7-21(2)8-14-24,25-15-9-22(3)10-16-25)20-28-31(29,30)26-17-11-23(4)12-18-26/h6-18,28H,1,19-20H2,2-4H3 |
| InChIKey | PFSGXGGOGFUHBM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |