C18H25NO2S — CID 156694376
N-[2,2-bis(prop-2-enyl)pent-4-enyl]-4-methylbenzenesulfonamide (PubChem CID 156694376) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is N-[2,2-bis(prop-2-enyl)pent-4-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2,2-bis(prop-2-enyl)pent-4-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 156694376 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[2,2-bis(prop-2-enyl)pent-4-enyl]-4-methylbenzenesulfonamide |
| SMILES | C=CCC(CC=C)(CC=C)CNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H25NO2S/c1-5-12-18(13-6-2,14-7-3)15-19-22(20,21)17-10-8-16(4)9-11-17/h5-11,19H,1-3,12-15H2,4H3 |
| InChIKey | QTCRSMIFKQUGSZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|