C9H12F2N2O2S — CID 130184477
N-(2-amino-2,2-difluoroethyl)-4-methylbenzenesulfonamide (PubChem CID 130184477) has the molecular formula C9H12F2N2O2S and a molecular weight of 250.27 g/mol. Its IUPAC name is N-(2-amino-2,2-difluoroethyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(2-amino-2,2-difluoroethyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 130184477 |
| Molecular Formula | C9H12F2N2O2S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | N-(2-amino-2,2-difluoroethyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(N)(F)F)cc1 |
| InChI | InChI=1S/C9H12F2N2O2S/c1-7-2-4-8(5-3-7)16(14,15)13-6-9(10,11)12/h2-5,13H,6,12H2,1H3 |
| InChIKey | YPUZRVMZXMOKHG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|