C26H27NO2S — CID 135016507
N-[(4E)-2,2-diphenylhepta-4,6-dienyl]-4-methylbenzenesulfonamide (PubChem CID 135016507) has the molecular formula C26H27NO2S and a molecular weight of 417.57 g/mol. Its IUPAC name is N-[(4E)-2,2-diphenylhepta-4,6-dienyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(4E)-2,2-diphenylhepta-4,6-dienyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135016507 |
| Molecular Formula | C26H27NO2S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-[(4E)-2,2-diphenylhepta-4,6-dienyl]-4-methylbenzenesulfonamide |
| SMILES | C=C/C=C/CC(CNS(=O)(=O)c1ccc(C)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO2S/c1-3-4-11-20-26(23-12-7-5-8-13-23,24-14-9-6-10-15-24)21-27-30(28,29)25-18-16-22(2)17-19-25/h3-19,27H,1,20-21H2,2H3/b11-4+ |
| InChIKey | VDWJTHJNZCANMH-NYYWCZLTSA-N |
| XLogP | 5.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|