C25H29NO2SSi — CID 102294027
N-[1-[dimethyl(phenyl)silyl]-1-phenylbut-3-enyl]-4-methylbenzenesulfonamide (PubChem CID 102294027) has the molecular formula C25H29NO2SSi and a molecular weight of 435.67 g/mol. Its IUPAC name is N-[1-[dimethyl(phenyl)silyl]-1-phenylbut-3-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-[dimethyl(phenyl)silyl]-1-phenylbut-3-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102294027 |
| Molecular Formula | C25H29NO2SSi |
| Molecular Weight | 435.67 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-[1-[dimethyl(phenyl)silyl]-1-phenylbut-3-enyl]-4-methylbenzenesulfonamide |
| SMILES | C=CCC(NS(=O)(=O)c1ccc(C)cc1)(c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C25H29NO2SSi/c1-5-20-25(22-12-8-6-9-13-22,30(3,4)24-14-10-7-11-15-24)26-29(27,28)23-18-16-21(2)17-19-23/h5-19,26H,1,20H2,2-4H3 |
| InChIKey | KYLDWIAIYUAPLL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.67 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|