C12H15NO3S — CID 69095347
N-(3-hydroxyhexa-1,5-dien-3-yl)benzenesulfonamide (PubChem CID 69095347) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is N-(3-hydroxyhexa-1,5-dien-3-yl)benzenesulfonamide.
| Compound Name | N-(3-hydroxyhexa-1,5-dien-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 69095347 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | N-(3-hydroxyhexa-1,5-dien-3-yl)benzenesulfonamide |
| SMILES | C=CCC(O)(C=C)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO3S/c1-3-10-12(14,4-2)13-17(15,16)11-8-6-5-7-9-11/h3-9,13-14H,1-2,10H2 |
| InChIKey | UCBAOUFFKYFHDO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|