C9H13NO4S — CID 172624828
N-(1,2-dihydroxypropan-2-yl)benzenesulfonamide (PubChem CID 172624828) has the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. Its IUPAC name is N-(1,2-dihydroxypropan-2-yl)benzenesulfonamide.
| Compound Name | N-(1,2-dihydroxypropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 172624828 |
| Molecular Formula | C9H13NO4S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | N-(1,2-dihydroxypropan-2-yl)benzenesulfonamide |
| SMILES | CC(O)(CO)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C9H13NO4S/c1-9(12,7-11)10-15(13,14)8-5-3-2-4-6-8/h2-6,10-12H,7H2,1H3 |
| InChIKey | FSRQAWPZAFWWHF-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|