C14H24N2O2S — CID 2314590
N-[1-(diethylamino)-2-methylpropan-2-yl]benzenesulfonamide (PubChem CID 2314590) has the molecular formula C14H24N2O2S and a molecular weight of 284.42 g/mol. Its IUPAC name is N-[1-(diethylamino)-2-methylpropan-2-yl]benzenesulfonamide.
| Compound Name | N-[1-(diethylamino)-2-methylpropan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 2314590 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N-[1-(diethylamino)-2-methylpropan-2-yl]benzenesulfonamide |
| SMILES | CCN(CC)CC(C)(C)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H24N2O2S/c1-5-16(6-2)12-14(3,4)15-19(17,18)13-10-8-7-9-11-13/h7-11,15H,5-6,12H2,1-4H3 |
| InChIKey | VGEZCCOUSGSBPH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |