C12H19NO3S2 — CID 95984417
N-[(2S)-2-hydroxy-2-methyl-4-methylsulfanylbutyl]benzenesulfonamide (PubChem CID 95984417) has the molecular formula C12H19NO3S2 and a molecular weight of 289.42 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-2-methyl-4-methylsulfanylbutyl]benzenesulfonamide.
| Compound Name | N-[(2S)-2-hydroxy-2-methyl-4-methylsulfanylbutyl]benzenesulfonamide |
|---|---|
| PubChem CID | 95984417 |
| Molecular Formula | C12H19NO3S2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | N-[(2S)-2-hydroxy-2-methyl-4-methylsulfanylbutyl]benzenesulfonamide |
| SMILES | CSCC[C@](C)(O)CNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H19NO3S2/c1-12(14,8-9-17-2)10-13-18(15,16)11-6-4-3-5-7-11/h3-7,13-14H,8-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | KWRBOMNPVOLGQP-LBPRGKRZSA-N |
| XLogP | 1.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |