C12H17NO3S — CID 90499346
N-(2-cyclopropyl-2-hydroxypropyl)benzenesulfonamide (PubChem CID 90499346) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is N-(2-cyclopropyl-2-hydroxypropyl)benzenesulfonamide.
| Compound Name | N-(2-cyclopropyl-2-hydroxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90499346 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-(2-cyclopropyl-2-hydroxypropyl)benzenesulfonamide |
| SMILES | CC(O)(CNS(=O)(=O)c1ccccc1)C1CC1 |
| InChI | InChI=1S/C12H17NO3S/c1-12(14,10-7-8-10)9-13-17(15,16)11-5-3-2-4-6-11/h2-6,10,13-14H,7-9H2,1H3 |
| InChIKey | QOPCFXMBCMCPKI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |