C12H13NO2S — CID 142835485
N-[(3E)-hexa-1,3,5-trien-3-yl]benzenesulfonamide (PubChem CID 142835485) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is N-[(3E)-hexa-1,3,5-trien-3-yl]benzenesulfonamide.
| Compound Name | N-[(3E)-hexa-1,3,5-trien-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 142835485 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | N-[(3E)-hexa-1,3,5-trien-3-yl]benzenesulfonamide |
| SMILES | C=C/C=C(\C=C)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H13NO2S/c1-3-8-11(4-2)13-16(14,15)12-9-6-5-7-10-12/h3-10,13H,1-2H2/b11-8+ |
| InChIKey | BHJMWFDPBXHWAR-DHZHZOJOSA-N |
| XLogP | 2.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|