C19H22S — CID 142310236
bis[(3E)-hexa-1,3,5-trien-3-yl]-methyl-phenyl-λ4-sulfane (PubChem CID 142310236) has the molecular formula C19H22S and a molecular weight of 282.45 g/mol. Its IUPAC name is bis[(3E)-hexa-1,3,5-trien-3-yl]-methyl-phenyl-λ4-sulfane.
| Compound Name | bis[(3E)-hexa-1,3,5-trien-3-yl]-methyl-phenyl-λ4-sulfane |
|---|---|
| PubChem CID | 142310236 |
| Molecular Formula | C19H22S |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | bis[(3E)-hexa-1,3,5-trien-3-yl]-methyl-phenyl-λ4-sulfane |
| SMILES | C=C/C=C(\C=C)S(C)(/C(C=C)=C/C=C)c1ccccc1 |
| InChI | InChI=1S/C19H22S/c1-6-13-17(8-3)20(5,18(9-4)14-7-2)19-15-11-10-12-16-19/h6-16H,1-4H2,5H3/b17-13+,18-14+ |
| InChIKey | LSCCLORCZRESAT-HBKJEHTGSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|