C17H26 — CID 177324817
ethane;[(3E)-3-ethenylhexa-3,5-dien-2-yl]benzene;methane (PubChem CID 177324817) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is ethane;[(3E)-3-ethenylhexa-3,5-dien-2-yl]benzene;methane.
| Compound Name | ethane;[(3E)-3-ethenylhexa-3,5-dien-2-yl]benzene;methane |
|---|---|
| PubChem CID | 177324817 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | ethane;[(3E)-3-ethenylhexa-3,5-dien-2-yl]benzene;methane |
| SMILES | C.C=C/C=C(\C=C)C(C)c1ccccc1.CC |
| InChI | InChI=1S/C14H16.C2H6.CH4/c1-4-9-13(5-2)12(3)14-10-7-6-8-11-14;1-2;/h4-12H,1-2H2,3H3;1-2H3;1H4/b13-9+;; |
| InChIKey | GKZQLGBPFKBMIT-IGUOPLJTSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|