C23H32O2 — CID 144703641
[(2E)-2-ethenyl-1-phenylpenta-2,4-dienyl] 2-tert-butyl-4-methylpentanoate (PubChem CID 144703641) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is [(2E)-2-ethenyl-1-phenylpenta-2,4-dienyl] 2-tert-butyl-4-methylpentanoate.
| Compound Name | [(2E)-2-ethenyl-1-phenylpenta-2,4-dienyl] 2-tert-butyl-4-methylpentanoate |
|---|---|
| PubChem CID | 144703641 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | [(2E)-2-ethenyl-1-phenylpenta-2,4-dienyl] 2-tert-butyl-4-methylpentanoate |
| SMILES | C=C/C=C(\C=C)C(OC(=O)C(CC(C)C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H32O2/c1-8-13-18(9-2)21(19-14-11-10-12-15-19)25-22(24)20(16-17(3)4)23(5,6)7/h8-15,17,20-21H,1-2,16H2,3-7H3/b18-13+ |
| InChIKey | JZKCNBFJSIWZIG-QGOAFFKASA-N |
| XLogP | 6.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|