C21H38 — CID 142240938
ethane;[(5E)-5-ethenylocta-5,7-dien-4-yl]benzene;methane (PubChem CID 142240938) has the molecular formula C21H38 and a molecular weight of 290.53 g/mol. Its IUPAC name is ethane;[(5E)-5-ethenylocta-5,7-dien-4-yl]benzene;methane.
| Compound Name | ethane;[(5E)-5-ethenylocta-5,7-dien-4-yl]benzene;methane |
|---|---|
| PubChem CID | 142240938 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.53 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | ethane;[(5E)-5-ethenylocta-5,7-dien-4-yl]benzene;methane |
| SMILES | C.C.C.C=C/C=C(\C=C)C(CCC)c1ccccc1.CC |
| InChI | InChI=1S/C16H20.C2H6.3CH4/c1-4-10-14(6-3)16(11-5-2)15-12-8-7-9-13-15;1-2;;;/h4,6-10,12-13,16H,1,3,5,11H2,2H3;1-2H3;3*1H4/b14-10+;;;; |
| InChIKey | ATPUCKHXDVCVPP-YOCKTNRLSA-N |
| XLogP | 7.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.53 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|