C17H23N — CID 88534907
(1Z,3E)-4-ethenyl-5-phenylnona-1,3-dien-1-amine (PubChem CID 88534907) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is (1Z,3E)-4-ethenyl-5-phenylnona-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-4-ethenyl-5-phenylnona-1,3-dien-1-amine |
|---|---|
| PubChem CID | 88534907 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (1Z,3E)-4-ethenyl-5-phenylnona-1,3-dien-1-amine |
| SMILES | C=C/C(=C\C=C/N)C(CCCC)c1ccccc1 |
| InChI | InChI=1S/C17H23N/c1-3-5-13-17(15(4-2)12-9-14-18)16-10-7-6-8-11-16/h4,6-12,14,17H,2-3,5,13,18H2,1H3/b14-9-,15-12+ |
| InChIKey | SYVLGPSZTIHXKQ-MJDFHZQASA-N |
| XLogP | 4.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|