C20H34 — CID 143940150
ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene;propane (PubChem CID 143940150) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene;propane.
| Compound Name | ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene;propane |
|---|---|
| PubChem CID | 143940150 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene;propane |
| SMILES | C=C/C=C(\C=C)Cc1ccccc1.CC.CC.CCC |
| InChI | InChI=1S/C13H14.C3H8.2C2H6/c1-3-8-12(4-2)11-13-9-6-5-7-10-13;1-3-2;2*1-2/h3-10H,1-2,11H2;3H2,1-2H3;2*1-2H3/b12-8+;;; |
| InChIKey | BHHQPDIGCUTVIO-ORBBEKEHSA-N |
| XLogP | 7.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|