About (2E)-2-ethenyl-N-ethylpenta-2,4-dien-1-amine;ethylbenzene
(2E)-2-ethenyl-N-ethylpenta-2,4-dien-1-amine;ethylbenzene (PubChem CID 164925034) has the molecular formula C17H25N
and a molecular weight of 243.39 g/mol. Its IUPAC name is (2E)-2-ethenyl-N-ethylpenta-2,4-dien-1-amine;ethylbenzene.
Molecular Properties
| Compound Name | (2E)-2-ethenyl-N-ethylpenta-2,4-dien-1-amine;ethylbenzene |
| PubChem CID | 164925034 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | (2E)-2-ethenyl-N-ethylpenta-2,4-dien-1-amine;ethylbenzene |
| SMILES | C=C/C=C(\C=C)CNCC.CCc1ccccc1 |
| InChI | InChI=1S/C9H15N.C8H10/c1-4-7-9(5-2)8-10-6-3;1-2-8-6-4-3-5-7-8/h4-5,7,10H,1-2,6,8H2,3H3;3-7H,2H2,1H3/b9-7+; |
| InChIKey | WIBSEOGOXQBZPI-BXTVWIJMSA-N |
| XLogP | 4.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-ethenyl-N-ethylpenta-2,4-dien-1-amine;ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-ethenyl-N-ethylpenta-2,4-dien-1-amine;ethylbenzene?
The IUPAC name of (2E)-2-ethenyl-N-ethylpenta-2,4-dien-1-amine;ethylbenzene (CID 164925034) is (2E)-2-ethenyl-N-ethylpenta-2,4-dien-1-amine;ethylbenzene.
What is the SMILES notation for (2E)-2-ethenyl-N-ethylpenta-2,4-dien-1-amine;ethylbenzene?
The canonical SMILES for (2E)-2-ethenyl-N-ethylpenta-2,4-dien-1-amine;ethylbenzene is C=C/C=C(\C=C)CNCC.CCc1ccccc1.
What is the InChIKey of (2E)-2-ethenyl-N-ethylpenta-2,4-dien-1-amine;ethylbenzene?
The InChIKey is WIBSEOGOXQBZPI-BXTVWIJMSA-N. The full InChI is InChI=1S/C9H15N.C8H10/c1-4-7-9(5-2)8-10-6-3;1-2-8-6-4-3-5-7-8/h4-5,7,10H,1-2,6,8H2,3H3;3-7H,2H2,1H3/b9-7+;.
What are the key properties of (2E)-2-ethenyl-N-ethylpenta-2,4-dien-1-amine;ethylbenzene?
(2E)-2-ethenyl-N-ethylpenta-2,4-dien-1-amine;ethylbenzene has a molecular weight of 243.39 g/mol, XLogP of 4.14, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-ethenyl-N-ethylpenta-2,4-dien-1-amine;ethylbenzene is sourced from PubChem (CID 164925034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).