About ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene
ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene (PubChem CID 142233164) has the molecular formula C15H20
and a molecular weight of 200.32 g/mol. Its IUPAC name is ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene.
Molecular Properties
| Compound Name | ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene |
| PubChem CID | 142233164 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene |
| SMILES | C=C/C=C(\C=C)Cc1ccccc1.CC |
| InChI | InChI=1S/C13H14.C2H6/c1-3-8-12(4-2)11-13-9-6-5-7-10-13;1-2/h3-10H,1-2,11H2;1-2H3/b12-8+; |
| InChIKey | JJNCFORJYNWMSX-MXZHIVQLSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene?
The IUPAC name of ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene (CID 142233164) is ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene.
What is the SMILES notation for ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene?
The canonical SMILES for ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene is C=C/C=C(\C=C)Cc1ccccc1.CC.
What is the InChIKey of ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene?
The InChIKey is JJNCFORJYNWMSX-MXZHIVQLSA-N. The full InChI is InChI=1S/C13H14.C2H6/c1-3-8-12(4-2)11-13-9-6-5-7-10-13;1-2/h3-10H,1-2,11H2;1-2H3/b12-8+;.
What are the key properties of ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene?
ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene has a molecular weight of 200.32 g/mol, XLogP of 4.55, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(2Z)-2-ethenylpenta-2,4-dienyl]benzene is sourced from PubChem (CID 142233164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).