C14H17N — CID 142908128
2-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-methylaniline (PubChem CID 142908128) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-methylaniline.
| Compound Name | 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-methylaniline |
|---|---|
| PubChem CID | 142908128 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 2-[(2Z)-2-ethenylpenta-2,4-dienyl]-N-methylaniline |
| SMILES | C=C/C=C(\C=C)Cc1ccccc1NC |
| InChI | InChI=1S/C14H17N/c1-4-8-12(5-2)11-13-9-6-7-10-14(13)15-3/h4-10,15H,1-2,11H2,3H3/b12-8+ |
| InChIKey | LBJCRVBRCZLRDK-XYOKQWHBSA-N |
| XLogP | 3.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|