C17H17N — CID 143380656
3-[(2Z)-2-ethenylpenta-2,4-dienyl]-2-methylquinoline (PubChem CID 143380656) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is 3-[(2Z)-2-ethenylpenta-2,4-dienyl]-2-methylquinoline.
| Compound Name | 3-[(2Z)-2-ethenylpenta-2,4-dienyl]-2-methylquinoline |
|---|---|
| PubChem CID | 143380656 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 3-[(2Z)-2-ethenylpenta-2,4-dienyl]-2-methylquinoline |
| SMILES | C=C/C=C(\C=C)Cc1cc2ccccc2nc1C |
| InChI | InChI=1S/C17H17N/c1-4-8-14(5-2)11-16-12-15-9-6-7-10-17(15)18-13(16)3/h4-10,12H,1-2,11H2,3H3/b14-8+ |
| InChIKey | KLRQCTIONYXISE-RIYZIHGNSA-N |
| XLogP | 4.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|