C28H26N2 — CID 143152848
4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-2,9-dimethyl-7-phenyl-1,10-phenanthroline (PubChem CID 143152848) has the molecular formula C28H26N2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-2,9-dimethyl-7-phenyl-1,10-phenanthroline.
| Compound Name | 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-2,9-dimethyl-7-phenyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 143152848 |
| Molecular Formula | C28H26N2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-2,9-dimethyl-7-phenyl-1,10-phenanthroline |
| SMILES | C=C/C(=C\C=C/C)Cc1cc(C)nc2c1ccc1c(-c3ccccc3)cc(C)nc12 |
| InChI | InChI=1S/C28H26N2/c1-5-7-11-21(6-2)18-23-16-19(3)29-27-24(23)14-15-25-26(17-20(4)30-28(25)27)22-12-9-8-10-13-22/h5-17H,2,18H2,1,3-4H3/b7-5-,21-11+ |
| InChIKey | SJWNFSSFJPSPPE-JYVFMYHASA-N |
| XLogP | 7.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|