C30H32N2Si2 — CID 137328798
[4-[7-(4-dimethylsilylphenyl)-2,9-dimethyl-1,10-phenanthrolin-4-yl]phenyl]-dimethylsilane (PubChem CID 137328798) has the molecular formula C30H32N2Si2 and a molecular weight of 476.77 g/mol. Its IUPAC name is [4-[7-(4-dimethylsilylphenyl)-2,9-dimethyl-1,10-phenanthrolin-4-yl]phenyl]-dimethylsilane.
| Compound Name | [4-[7-(4-dimethylsilylphenyl)-2,9-dimethyl-1,10-phenanthrolin-4-yl]phenyl]-dimethylsilane |
|---|---|
| PubChem CID | 137328798 |
| Molecular Formula | C30H32N2Si2 |
| Molecular Weight | 476.77 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | [4-[7-(4-dimethylsilylphenyl)-2,9-dimethyl-1,10-phenanthrolin-4-yl]phenyl]-dimethylsilane |
| SMILES | Cc1cc(-c2ccc([SiH](C)C)cc2)c2ccc3c(-c4ccc([SiH](C)C)cc4)cc(C)nc3c2n1 |
| InChI | InChI=1S/C30H32N2Si2/c1-19-17-27(21-7-11-23(12-8-21)33(3)4)25-15-16-26-28(18-20(2)32-30(26)29(25)31-19)22-9-13-24(14-10-22)34(5)6/h7-18,33-34H,1-6H3 |
| InChIKey | VFQXLBBXYMDOEY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.77 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|