C34H26N4 — CID 102191847
5-[4-(2,9-dimethyl-1,10-phenanthrolin-5-yl)phenyl]-2,9-dimethyl-1,10-phenanthroline (PubChem CID 102191847) has the molecular formula C34H26N4 and a molecular weight of 490.61 g/mol. Its IUPAC name is 5-[4-(2,9-dimethyl-1,10-phenanthrolin-5-yl)phenyl]-2,9-dimethyl-1,10-phenanthroline.
| Compound Name | 5-[4-(2,9-dimethyl-1,10-phenanthrolin-5-yl)phenyl]-2,9-dimethyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 102191847 |
| Molecular Formula | C34H26N4 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 5-[4-(2,9-dimethyl-1,10-phenanthrolin-5-yl)phenyl]-2,9-dimethyl-1,10-phenanthroline |
| SMILES | Cc1ccc2cc(-c3ccc(-c4cc5ccc(C)nc5c5nc(C)ccc45)cc3)c3ccc(C)nc3c2n1 |
| InChI | InChI=1S/C34H26N4/c1-19-5-9-25-17-29(27-15-7-21(3)37-33(27)31(25)35-19)23-11-13-24(14-12-23)30-18-26-10-6-20(2)36-32(26)34-28(30)16-8-22(4)38-34/h5-18H,1-4H3 |
| InChIKey | MIHPYKYVQWNAFC-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|