C23H24N2Si — CID 11485093
[4-(2,9-dimethyl-1,10-phenanthrolin-5-yl)phenyl]-trimethylsilane (PubChem CID 11485093) has the molecular formula C23H24N2Si and a molecular weight of 356.55 g/mol. Its IUPAC name is [4-(2,9-dimethyl-1,10-phenanthrolin-5-yl)phenyl]-trimethylsilane.
| Compound Name | [4-(2,9-dimethyl-1,10-phenanthrolin-5-yl)phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 11485093 |
| Molecular Formula | C23H24N2Si |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [4-(2,9-dimethyl-1,10-phenanthrolin-5-yl)phenyl]-trimethylsilane |
| SMILES | Cc1ccc2cc(-c3ccc([Si](C)(C)C)cc3)c3ccc(C)nc3c2n1 |
| InChI | InChI=1S/C23H24N2Si/c1-15-6-8-18-14-21(17-9-11-19(12-10-17)26(3,4)5)20-13-7-16(2)25-23(20)22(18)24-15/h6-14H,1-5H3 |
| InChIKey | OYCRGTSJDNVMLU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|