C50H50Si2 — CID 59391265
[4-[3,8-bis(2,6-dimethylphenyl)-6-(4-trimethylsilylphenyl)pyren-1-yl]phenyl]-trimethylsilane (PubChem CID 59391265) has the molecular formula C50H50Si2 and a molecular weight of 707.12 g/mol. Its IUPAC name is [4-[3,8-bis(2,6-dimethylphenyl)-6-(4-trimethylsilylphenyl)pyren-1-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[3,8-bis(2,6-dimethylphenyl)-6-(4-trimethylsilylphenyl)pyren-1-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 59391265 |
| Molecular Formula | C50H50Si2 |
| Molecular Weight | 707.12 g/mol |
| Exact Mass | 706.35 |
| IUPAC Name | [4-[3,8-bis(2,6-dimethylphenyl)-6-(4-trimethylsilylphenyl)pyren-1-yl]phenyl]-trimethylsilane |
| SMILES | Cc1cccc(C)c1-c1cc(-c2ccc([Si](C)(C)C)cc2)c2ccc3c(-c4c(C)cccc4C)cc(-c4ccc([Si](C)(C)C)cc4)c4ccc1c2c43 |
| InChI | InChI=1S/C50H50Si2/c1-31-13-11-14-32(2)47(31)45-29-43(35-17-21-37(22-18-35)51(5,6)7)39-26-28-42-46(48-33(3)15-12-16-34(48)4)30-44(40-25-27-41(45)49(39)50(40)42)36-19-23-38(24-20-36)52(8,9)10/h11-30H,1-10H3 |
| InChIKey | ZKALXPLLCHEORD-UHFFFAOYSA-N |
| XLogP | 13.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.12 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|